(6'-acetyloxy-5-nitro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate structure
|
Common Name | (6'-acetyloxy-5-nitro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 14926-29-5 | Molecular Weight | 461.37700 | |
| Density | 1.56g/cm3 | Boiling Point | 666.2ºC at 760mmHg | |
| Molecular Formula | C24H15NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273ºC | |
| Name | (6'-acetyloxy-5-nitro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 666.2ºC at 760mmHg |
| Molecular Formula | C24H15NO9 |
| Molecular Weight | 461.37700 |
| Flash Point | 273ºC |
| Exact Mass | 461.07500 |
| PSA | 133.95000 |
| LogP | 4.53660 |
| Vapour Pressure | 1.29E-17mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | BQPPOWMXCZRFHE-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(OC(C)=O)ccc1C21OC(=O)c2cc([N+](=O)[O-])ccc21 |
| HS Code | 2932999099 |
|---|
|
~28%
(6'-acetyloxy-5... CAS#:14926-29-5
Detail
|
| Literature: Helvetica Chimica Acta, , vol. 86, # 7 p. 2299 - 2334 |
|
~%
(6'-acetyloxy-5... CAS#:14926-29-5
Detail
|
| Literature: ACS Medicinal Chemistry Letters, , vol. 3, # 9 p. 774 - 779 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitrofluorescein Diacetate |
| 3',6'-bis(acetyloxy)-5-nitrospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one |
| 3',6'-di-O-acetyl-5-nitrofluorescein |
| 3',6'-Diacetoxy-5-nitro-spiro[phthalan-1,9'-xanthen]-3-on |
| 4-Nitro-fluorescein-diacetat |
| 5-Nitrofluorescein diacetate |
| 5-nitro-3-oxo-3h-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diyl diacetate |
| 3',6'-diacetoxy-5-nitro-spiro[phthalan-1,9'-xanthen]-3-one |