3,4-bis(methoxymethoxy)benzoic Acid
Modify Date: 2026-07-10 17:23:09
3,4-bis(methoxymethoxy)benzoic Acid structure
|
Common Name | 3,4-bis(methoxymethoxy)benzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 149220-87-1 | Molecular Weight | 242.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-bis(methoxymethoxy)benzoic Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14O6 |
|---|---|
| Molecular Weight | 242.22 |
| InChIKey | RPXJIJXOAQZKFO-UHFFFAOYSA-N |
| SMILES | COCOc1ccc(C(=O)O)cc1OCOC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,4-bis(methoxymethoxy)benzoic Acid? |
| A: InChIKey of 3,4-bis(methoxymethoxy)benzoic Acid is RPXJIJXOAQZKFO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 149220-87-1? |
| A: Chinese name of 149220-87-1 is 149220-87-1. |
| Q: What is the molecular weight of 3,4-bis(methoxymethoxy)benzoic Acid? |
| A: Molecular weight of 3,4-bis(methoxymethoxy)benzoic Acid is 242.22. |
| Q: What is the English name of 3,4-bis(methoxymethoxy)benzoic Acid? |
| A: The English name of 3,4-bis(methoxymethoxy)benzoic Acid is 3,4-bis(methoxymethoxy)benzoic Acid. |
| Q: What is the CAS number of 3,4-bis(methoxymethoxy)benzoic Acid? |
| A: CAS number of 3,4-bis(methoxymethoxy)benzoic Acid is 149220-87-1. |
| Q: What is the molecular formula of 3,4-bis(methoxymethoxy)benzoic Acid? |
| A: Molecular formula of 3,4-bis(methoxymethoxy)benzoic Acid is C11H14O6. |
| Q: What is the SMILES notation of 3,4-bis(methoxymethoxy)benzoic Acid? |
| A: SMILES notation of 3,4-bis(methoxymethoxy)benzoic Acid is COCOc1ccc(C(=O)O)cc1OCOC. |