Isobutyl 2,2-dimethyl-5-(2,5-xylyloxy)valerate structure
|
Common Name | Isobutyl 2,2-dimethyl-5-(2,5-xylyloxy)valerate | ||
|---|---|---|---|---|
| CAS Number | 149105-26-0 | Molecular Weight | 306.440 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 390.0±30.0 °C at 760 mmHg | |
| Molecular Formula | C19H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.4±19.2 °C | |
| Name | 2-methylpropyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.0±30.0 °C at 760 mmHg |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.440 |
| Flash Point | 164.4±19.2 °C |
| Exact Mass | 306.219482 |
| PSA | 35.53000 |
| LogP | 5.84 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | REPYTKNMHNVOPH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)OCC(C)C)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Pentanoic acid,5-(2,5-dimethylphenoxy)-2,2-dimethyl-,2-methylpropyl ester |
| Pentanoic acid, 5-(2,5-dimethylphenoxy)-2,2-dimethyl-, 2-methylpropyl ester |
| gemfibrozil isobutyl ester |
| DL-Naproxen:2,2-Dimethyl-5-(2,5xylyloxy) valeric isobutyl ester |
| Isobutyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
| Isobutyl 2,2-Dimethyl-5-(2,5-Xylyloxy)Valerate |
| 2-methylpropyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
| DL-Naproxen:2,2-Dimethyl-5-(2,5xylyloxy) valeric isobutyl ester[Gemfibrozil intermediate] |