Procaspase-IN-5 structure
|
Common Name | Procaspase-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 1489285-17-7 | Molecular Weight | 388.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12N2O3S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Procaspase-IN-5Procaspase-IN-5 is a human DNA polymerase λ inhibitor. Procaspase-IN-5 has DNA polymerization function and TdT function with an IC50 value of 5.9 μM and 4.5 μM, respectively. Procaspase-IN-5 can be used for the research of cancer[1]. |
| Name | Procaspase-IN-5 |
|---|
| Description | Procaspase-IN-5 is a human DNA polymerase λ inhibitor. Procaspase-IN-5 has DNA polymerization function and TdT function with an IC50 value of 5.9 μM and 4.5 μM, respectively. Procaspase-IN-5 can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 5.9 μM (DNA polymerization function); 4.5 μM (TdT function)[1]. |
| References |
| Molecular Formula | C17H12N2O3S3 |
|---|---|
| Molecular Weight | 388.48 |
| InChIKey | SHKDXDWJERWCHI-DHDCSXOGSA-N |
| SMILES | Cc1ccccc1Sc1ccc(C=C2SC(=S)NC2=O)cc1[N+](=O)[O-] |