2-(3,4-dichlorophenyl)quinoline-4-carboxylic acid
Modify Date: 2025-10-01 07:50:22
2-(3,4-dichlorophenyl)quinoline-4-carboxylic acid structure
|
Common Name | 2-(3,4-dichlorophenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 148887-61-0 | Molecular Weight | 318.15400 | |
| Density | 1.456g/cm3 | Boiling Point | 506.6ºC at 760mmHg | |
| Molecular Formula | C16H9Cl2NO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 260.2ºC | |
| Name | 2-(3,4-dichlorophenyl)quinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 506.6ºC at 760mmHg |
| Molecular Formula | C16H9Cl2NO2 |
| Molecular Weight | 318.15400 |
| Flash Point | 260.2ºC |
| Exact Mass | 317.00100 |
| PSA | 50.19000 |
| LogP | 4.90680 |
| Vapour Pressure | 4.37E-11mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | METUEFNOMUIMQR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933499090 |
|
~94%
2-(3,4-dichloro... CAS#:148887-61-0 |
| Literature: Nicolaie, E; Guengoer, T; Goyard, J; Cure, G; Fouquet, A; et al. European Journal of Medicinal Chemistry, 1992 , vol. 27, # 9 p. 977 - 984 |
|
~%
2-(3,4-dichloro... CAS#:148887-61-0 |
| Literature: Yu, Xiang Y.; Hill, Jason M.; Yu, Guixue; Yang, Yifeng; Kluge, Arthur F.; Keith, Dennis; Finn, John; Gallant, Paul; Silverman, Jared; Lim, Audrey Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 4 p. 541 - 544 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3,4-Dichlor-phenyl)-chinolin-4-carbonsaeure |
| 2-(1H-PYRAZOL-1-YL)ISONICOTINONITRILE |
| 2-(3,4-dichlorophenyl)-quinoline-4-carboxylic acid |
| 4-Quinolinecarboxylicacid,2-(3,4-dichlorophenyl) |