Methyl 3-[(3-Formylphenoxy)methyl]benzoate structure
|
Common Name | Methyl 3-[(3-Formylphenoxy)methyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 148254-63-1 | Molecular Weight | 270.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 3-[(3-Formylphenoxy)methyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14O4 |
|---|---|
| Molecular Weight | 270.28000 |
| Exact Mass | 270.08900 |
| PSA | 52.60000 |
| LogP | 2.86470 |
| InChIKey | HJHCXQJVDANXSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(COc2cccc(C=O)c2)c1 |
| HS Code | 2918990090 |
|---|
|
~90%
Methyl 3-[(3-Fo... CAS#:148254-63-1 |
| Literature: Sawada, Kozo; Okada, Satoshi; Golden, Patrick; Kayakiri, Natsuko; Sawada, Yuki; Hashimoto, Masashi; Tanaka, Hirokazu Chemical and Pharmaceutical Bulletin, 1999 , vol. 47, # 4 p. 481 - 491 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl (3-cyanophenyl)propanoate |
| methyl-3-(3-cyanophenyl)propanoate |
| 3-(3-cyano-phenyl)-propionic acid methyl ester |
| Benzenepropanoic acid,3-cyano-,methyl ester |
| methyl 3-(3-cyanophenyl)propionate |
| methyl 3-((3-formylphenoxy)methyl)benzoate |