2-methyl-N-(2,2,2-trichloro-1-hydroxyethyl)prop-2-enamide structure
|
Common Name | 2-methyl-N-(2,2,2-trichloro-1-hydroxyethyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 14825-93-5 | Molecular Weight | 232.49200 | |
| Density | 1.448g/cm3 | Boiling Point | 344.1ºC at 760mmHg | |
| Molecular Formula | C6H8Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | 2-methyl-N-(2,2,2-trichloro-1-hydroxyethyl)prop-2-enamide |
|---|
| Density | 1.448g/cm3 |
|---|---|
| Boiling Point | 344.1ºC at 760mmHg |
| Molecular Formula | C6H8Cl3NO2 |
| Molecular Weight | 232.49200 |
| Flash Point | 161.9ºC |
| Exact Mass | 230.96200 |
| PSA | 52.82000 |
| LogP | 2.20760 |
| Vapour Pressure | 4.31E-06mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | HYIOVDDWOCTHOG-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)NC(O)C(Cl)(Cl)Cl |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |