DiPT
Modify Date: 2025-10-23 01:24:59
DiPT structure
|
Common Name | DiPT | ||
|---|---|---|---|---|
| CAS Number | 14780-24-6 | Molecular Weight | 244.375 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 376.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C16H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4±23.2 °C | |
| Name | N,N-diisopropyltryptamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.4±25.0 °C at 760 mmHg |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.375 |
| Flash Point | 181.4±23.2 °C |
| Exact Mass | 244.193954 |
| PSA | 19.03000 |
| LogP | 3.82 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | ZRVAAGAZUWXRIP-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCc1c[nH]c2ccccc12)C(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-[2-(1H-Indol-3-yl)ethyl]-N-isopropylpropan-2-amine |
| INDOLE, 3-(2-(DIISOPROPYLAMINO)ETHYL)- |
| N,N-Diisopropyltryptamine |
| N,N-Diisopropyltryptamine(DIPT) |
| N-[2-(1H-Indol-3-yl)ethyl]-N-isopropyl-2-propanamine |
| DiPT |
| 1H-Indole-3-ethanamine, N,N-bis(1-methylethyl)- |