2-propanoylnaphthalene-1,4-dione structure
|
Common Name | 2-propanoylnaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 14777-30-1 | Molecular Weight | 214.21700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-propanoylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10O3 |
|---|---|
| Molecular Weight | 214.21700 |
| Exact Mass | 214.06300 |
| PSA | 51.21000 |
| LogP | 1.97110 |
| InChIKey | RDZZFOBERIJIJN-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=O)c2ccccc2C1=O |
|
~92%
2-propanoylnaph... CAS#:14777-30-1 |
| Literature: Oelgemoeller, Michael; Schiel, Christian; Froehlich, Roland; Mattay, Jochen European Journal of Organic Chemistry, 2002 , # 15 p. 2465 - 2474 |
|
~%
2-propanoylnaph... CAS#:14777-30-1 |
| Literature: Oelgemoeller, Michael; Schiel, Christian; Froehlich, Roland; Mattay, Jochen European Journal of Organic Chemistry, 2002 , # 15 p. 2465 - 2474 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Propanoyl-1,4-naphthochinon |
| 2-Propionyl-1,4-naphthochinon |
| 2-propanoyl-1,4-naphthoquinone |
| 2-propionyl-1,4-naphthoquinone |