9-Benxyloxy-3-(2-Chloro ethyl)-2-methyl pyrido[1,2-a]pyrimidine-4-one structure
|
Common Name | 9-Benxyloxy-3-(2-Chloro ethyl)-2-methyl pyrido[1,2-a]pyrimidine-4-one | ||
|---|---|---|---|---|
| CAS Number | 147687-17-0 | Molecular Weight | 328.793 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 505.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C18H17ClN2O2 | Melting Point | 140-142ºC | |
| MSDS | N/A | Flash Point | 259.2±32.9 °C | |
| Name | 3-(2-chloroethyl)-2-methyl-9-phenylmethoxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 505.0±60.0 °C at 760 mmHg |
| Melting Point | 140-142ºC |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.793 |
| Flash Point | 259.2±32.9 °C |
| Exact Mass | 328.097870 |
| PSA | 43.60000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | DFZLZGAIWJGCIJ-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(OCc3ccccc3)cccn2c(=O)c1CCCl |
| Storage condition | Refrigerator |
| HS Code | 2933990090 |
|---|
|
~69%
9-Benxyloxy-3-(... CAS#:147687-17-0 |
| Literature: ORCHID CHEMICALS and PHARMACEUTICALS LIMITED Patent: US2010/298566 A1, 2010 ; Location in patent: Page/Page column 6 ; |
|
~70%
9-Benxyloxy-3-(... CAS#:147687-17-0 |
| Literature: NATCO PHARMA LIMITED Patent: WO2009/10988 A1, 2009 ; Location in patent: Page/Page column 13 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4H-Pyrido[1,2-a]pyrimidin-4-one,3-(2-chloroethyl)-2-methyl-9-(phenylmethoxy) |
| 9-(Benzyloxy)-3-(2-chlorethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-on |
| 9-(Benzyloxy)-3-(2-chloroethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one |
| 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-chloroethyl)-2-methyl-9-(phenylmethoxy)- |
| 3-(2-Chloroethyl)-2-methyl-9-benzyloxy-4H-pyrido[1,2-a]pyrimidin-4-one |
| 3-(2-chloroethyl)-9-benzyloxy-2-methyl-4H-pyrido[1,2-a]pyrimidine-4-one |
| 9-benzyloxy-3-(2-chloro-ethyl)-2-methyl-pyrido[1,2-a]pyrimidin-4-one |
| 3-(2-chloromethyl)-2-methyl-9-(phenylmethoxy)-4H-pyrido[1,2a]pyrimidine-4-one |
| 9-benzyloxy-3-(2-chloroethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one |
| 3-(2-chloroethyl)-2-methyl-9-benzyloxy-4H-pyrido[1,2-a]pyrimidine-4-one |
| 3-(2-chloroethyl)-2-methyl-9-(phenylmethoxy)-4H-pyrido[1,2-a]pyrimidin-4-one |
| 9-Benxyloxy-3-(2-Chloroethyl)-2-methylpyrido[1,2-a]pyrimidine-4-one |
| 9-benzyloxy-3-(2-chloroethyl)-2-methylpyrido[1,2-a]pyrimidine-4-one |