Silicic acid (H6Si2O7),hexakis(2-ethylbutyl) ester (9CI) structure
|
Common Name | Silicic acid (H6Si2O7),hexakis(2-ethylbutyl) ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 1476-03-5 | Molecular Weight | 679.17100 | |
| Density | 0.916g/cm3 | Boiling Point | 582.4ºC at 760mmHg | |
| Molecular Formula | C36H78O7Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.3ºC | |
| Name | tris(2-ethylbutyl) tris(2-ethylbutoxy)silyl silicate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.916g/cm3 |
|---|---|
| Boiling Point | 582.4ºC at 760mmHg |
| Molecular Formula | C36H78O7Si2 |
| Molecular Weight | 679.17100 |
| Flash Point | 269.3ºC |
| Exact Mass | 678.52900 |
| PSA | 64.61000 |
| LogP | 10.59100 |
| Vapour Pressure | 6.04E-13mmHg at 25°C |
| Index of Refraction | 1.447 |
| InChIKey | LZABKCXEHHOOHI-UHFFFAOYSA-N |
| SMILES | CCC(CC)CO[Si](OCC(CC)CC)(OCC(CC)CC)O[Si](OCC(CC)CC)(OCC(CC)CC)OCC(CC)CC |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Hexakis-(2-aethyl-butoxy)-disiloxan |
| hexakis-(2-ethyl-butoxy)-disiloxane |
| tris(2-ethylbutyl) tris(2-ethylbutoxy)silyl orthosilicate |
| HEXA(2-ETHYLBUTOXY)DISILOXANE |
| Dikieselsaeure-hexakis-(2-aethyl-butylester) |
| disilicic acid hexakis-(2-ethyl-butyl ester) |
| Hexakis-<2-aethyl-butyloxy>-disiloxan |