tert-butyl 2-(3-formylphenoxy)acetate
Modify Date: 2025-09-18 11:58:40
tert-butyl 2-(3-formylphenoxy)acetate structure
|
Common Name | tert-butyl 2-(3-formylphenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 147593-90-6 | Molecular Weight | 236.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 2-(3-formylphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O4 |
|---|---|
| Molecular Weight | 236.26400 |
| Exact Mass | 236.10500 |
| PSA | 52.60000 |
| LogP | 2.21960 |
| InChIKey | IOHGZBLANANFDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COc1cccc(C=O)c1 |
| HS Code | 2918990090 |
|---|
|
~96%
tert-butyl 2-(3... CAS#:147593-90-6 |
| Literature: Schlundt, Sebastian; Kuzmanich, Gregory; Spaenig, Fabian; De Miguel Rojas, Gustavo; Kovacs, Christian; Garcia-Garibay, Miguel A.; Guldi, Dirk M.; Hirsch, Andreas Chemistry - A European Journal, 2009 , vol. 15, # 45 p. 12223 - 12233 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-tert-butoxycarbonylmethyloxy-benzaldehyde |