5-Chloro-3-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl]benzoxazol-2(3H)-one structure
|
Common Name | 5-Chloro-3-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl]benzoxazol-2(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 14733-75-6 | Molecular Weight | 339.81700 | |
| Density | 1.292g/cm3 | Boiling Point | 501.8ºC at 760mmHg | |
| Molecular Formula | C16H22ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.3ºC | |
| Name | 5-chloro-3-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl]-1,3-benzoxazol-2-one |
|---|
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 501.8ºC at 760mmHg |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.81700 |
| Flash Point | 257.3ºC |
| Exact Mass | 339.13500 |
| PSA | 61.85000 |
| LogP | 1.12370 |
| Vapour Pressure | 6.87E-11mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | XTDOOWXLTBAVKL-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccc(Cl)cc2n1CCCN1CCN(CCO)CC1 |
| HS Code | 2934999090 |
|---|
|
~%
5-Chloro-3-[3-[... CAS#:14733-75-6 |
| Literature: Sam,J. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 408 - 410 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |