HBV Seq1 aa:141-151
Modify Date: 2024-04-13 18:27:11
HBV Seq1 aa:141-151 structure
|
Common Name | HBV Seq1 aa:141-151 | ||
|---|---|---|---|---|
| CAS Number | 147318-53-4 | Molecular Weight | 1258.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C53H95N17O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HBV Seq1 aa:141-151HBV Seq1 aa:141-151 is a peptide. HBV Seq1 aa:141-151 can be used for the research of chronic hepatitis B virus (HBV) [1]. |
| Name | HBV Seq1 aa:141-151 |
|---|
| Description | HBV Seq1 aa:141-151 is a peptide. HBV Seq1 aa:141-151 can be used for the research of chronic hepatitis B virus (HBV) [1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C53H95N17O18 |
|---|---|
| Molecular Weight | 1258.42 |
| InChIKey | LSLQYXCVNVBNJL-DGBWKTDHSA-N |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C(N)CO)C(C)O)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O)C(C)C)C(C)C)C(C)O)C(C)O |