1,2,3-Propanetriol 2,2a(2),2a(2)a(2)-triester with boric acid (H3BO3)
Modify Date: 2025-09-11 12:26:42
1,2,3-Propanetriol 2,2a(2),2a(2)a(2)-triester with boric acid (H3BO3) structure
|
Common Name | 1,2,3-Propanetriol 2,2a(2),2a(2)a(2)-triester with boric acid (H3BO3) | ||
|---|---|---|---|---|
| CAS Number | 1472633-72-9 | Molecular Weight | 284.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H21BO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3-Propanetriol 2,2a(2),2a(2)a(2)-triester with boric acid (H3BO3) |
|---|
| Molecular Formula | C9H21BO9 |
|---|---|
| Molecular Weight | 284.07 |
OCC(CO)OB(OC(CO)CO)OC(CO)CO