DPM-1001
Modify Date: 2025-08-21 16:36:38
DPM-1001 structure
|
Common Name | DPM-1001 | ||
|---|---|---|---|---|
| CAS Number | 1471172-27-6 | Molecular Weight | 567.85 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H57N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DPM-1001DPM-1001 is a potent, specific, orally bioavailable and non-competitive inhibitor of protein-tyrosine phosphatase (PTP1B) with an IC50 of 100 nM, an an analog of the specific PTP1B inhibitor trodusquemine (MSI-1436; IC50=600 nM). DPM-1001 has anti-diabetic property[1]. |
| Name | DPM-1001 |
|---|
| Description | DPM-1001 is a potent, specific, orally bioavailable and non-competitive inhibitor of protein-tyrosine phosphatase (PTP1B) with an IC50 of 100 nM, an an analog of the specific PTP1B inhibitor trodusquemine (MSI-1436; IC50=600 nM). DPM-1001 has anti-diabetic property[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 100 nM (PTP1B)[1] |
| References |
| Molecular Formula | C35H57N3O3 |
|---|---|
| Molecular Weight | 567.85 |
| InChIKey | RVANDQULNPITCN-MCVYBXALSA-N |
| SMILES | COC(=O)CCC(C)C1CCC2C3C(O)CC4CC(NCCCCNCc5ccccn5)CCC4(C)C3CCC12C |