1,2-bis-(Acetoacetylamino)ethane structure
|
Common Name | 1,2-bis-(Acetoacetylamino)ethane | ||
|---|---|---|---|---|
| CAS Number | 1471-94-9 | Molecular Weight | 228.24500 | |
| Density | 1.142g/cm3 | Boiling Point | 539.3ºC at 760 mmHg | |
| Molecular Formula | C10H16N2O4 | Melting Point | 149-151ºC | |
| MSDS | USA | Flash Point | 231.9ºC | |
| Name | 3-oxo-N-[2-(3-oxobutanoylamino)ethyl]butanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 539.3ºC at 760 mmHg |
| Melting Point | 149-151ºC |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.24500 |
| Flash Point | 231.9ºC |
| Exact Mass | 228.11100 |
| PSA | 92.34000 |
| Vapour Pressure | 1.06E-11mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | KLZDEEDOBAPARF-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NCCNC(=O)CC(C)=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2924199090 |
|
~91%
1,2-bis-(Acetoa... CAS#:1471-94-9 |
| Literature: Beger, J.; Thielemann, C. Journal fuer Praktische Chemie (Leipzig), 1981 , vol. 323, # 2 p. 337 - 344 |
|
~%
1,2-bis-(Acetoa... CAS#:1471-94-9 |
| Literature: Kogyo Kagaku Zasshi, , vol. 58, p. 67 Chem.Abstr., , p. 4008 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethylenediaminebisacetoacetamide |
| Di-Acetoacetylethylenediamine |
| MFCD00014967 |
| N,N'-Aethandiyl-bis-acetoacetamid |
| N,N'-ethanediyl-bis-acetoacetamide |
| EINECS 216-011-0 |
| N,N'-Bis-acetoacetyl-1,2-diaminoethan |