L-6424
Modify Date: 2025-08-25 16:44:32
L-6424 structure
|
Common Name | L-6424 | ||
|---|---|---|---|---|
| CAS Number | 147030-50-0 | Molecular Weight | 420.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-6424L-6424 inhibits T3 binding to α1-T3R and β1-T3R[1]. |
| Name | (2-butyl-1-benzofuran-3-yl)-(4-hydroxy-3-iodophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Description | L-6424 inhibits T3 binding to α1-T3R and β1-T3R[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H17IO3 |
|---|---|
| Molecular Weight | 420.24100 |
| Exact Mass | 420.02200 |
| PSA | 50.44000 |
| LogP | 5.31660 |
| InChIKey | SPJWRQCARFHMEB-UHFFFAOYSA-N |
| SMILES | CCCCc1oc2ccccc2c1C(=O)c1ccc(O)c(I)c1 |
| l 6424 |
| unii-378vh98mb8 |
| Amiodarone Impurity 6 |