3-methoxy-N,N-dimethyl-4-nitroaniline structure
|
Common Name | 3-methoxy-N,N-dimethyl-4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 14703-82-3 | Molecular Weight | 196.20300 | |
| Density | 1.201g/cm3 | Boiling Point | 327.9ºC at 760mmHg | |
| Molecular Formula | C9H12N2O3 | Melting Point | 125-126ºC | |
| MSDS | N/A | Flash Point | 152.1ºC | |
| Name | 3-methoxy-N,N-dimethyl-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 327.9ºC at 760mmHg |
| Melting Point | 125-126ºC |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.20300 |
| Flash Point | 152.1ºC |
| Exact Mass | 196.08500 |
| PSA | 58.29000 |
| LogP | 2.19260 |
| Vapour Pressure | 0.000196mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | SJPYRQAJLGWUSP-UHFFFAOYSA-N |
| SMILES | COc1cc(N(C)C)ccc1[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methoxynitrophenyldimethylamine |