3-(methylamino)-4-nitrophenol
Modify Date: 2025-11-25 17:18:05
3-(methylamino)-4-nitrophenol structure
|
Common Name | 3-(methylamino)-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 14703-79-8 | Molecular Weight | 168.15000 | |
| Density | 1.411g/cm3 | Boiling Point | 384.1ºC at 760mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.1ºC | |
| Name | 3-(methylamino)-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 384.1ºC at 760mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15000 |
| Flash Point | 186.1ºC |
| Exact Mass | 168.05300 |
| PSA | 78.08000 |
| LogP | 1.93830 |
| Vapour Pressure | 1.9E-06mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | RLGZWWJLIPEADI-UHFFFAOYSA-N |
| SMILES | CNc1cc(O)ccc1[N+](=O)[O-] |
| HS Code | 2922299090 |
|---|
|
~96%
3-(methylamino)... CAS#:14703-79-8 |
| Literature: SGX PHARMACEUTICALS, INC. Patent: WO2008/51808 A2, 2008 ; Location in patent: Page/Page column 83 ; WO 2008/051808 A2 |
|
~%
3-(methylamino)... CAS#:14703-79-8 |
| Literature: Societe Anonyme dite: L'OREAL Patent: US4337061 A1, 1982 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Hydroxy-2-methylamino-1-nitro-benzol |
| 3-methylamino-4-nitro-phenol |
| 4-nitro 5-N-methylamino phenol |