5-nitro-N-phenylthiophene-3-carboxamide
Modify Date: 2025-08-26 23:37:54
5-nitro-N-phenylthiophene-3-carboxamide structure
|
Common Name | 5-nitro-N-phenylthiophene-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 146795-34-8 | Molecular Weight | 248.25800 | |
| Density | 1.463g/cm3 | Boiling Point | 331.8ºC at 760mmHg | |
| Molecular Formula | C11H8N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.4ºC | |
| Name | 5-nitro-N-phenylthiophene-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.463g/cm3 |
|---|---|
| Boiling Point | 331.8ºC at 760mmHg |
| Molecular Formula | C11H8N2O3S |
| Molecular Weight | 248.25800 |
| Flash Point | 154.4ºC |
| Exact Mass | 248.02600 |
| PSA | 106.65000 |
| LogP | 3.81580 |
| Vapour Pressure | 0.000153mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | AMPJDTBJASSLGJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)c1csc([N+](=O)[O-])c1 |
|
~%
5-nitro-N-pheny... CAS#:146795-34-8 |
| Literature: Campaigne; Bourgeois Journal of the American Chemical Society, 1954 , vol. 76, p. 2445 |
|
~%
5-nitro-N-pheny... CAS#:146795-34-8 |
| Literature: Campaigne; Bourgeois Journal of the American Chemical Society, 1954 , vol. 76, p. 2445 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Nitro-thiophen-3-carbonsaeure-anilid |
| N-Phenyl-5-nitro-3-thiophenecarboxamide |
| 5-Nitro-3-thiophenecarboxanilide |
| 3-Thiophenecarboxamide,5-nitro-N-phenyl |
| 5-Nitro-N-phenyl-3-thiophenecarboxamide |
| 5-nitro-thiophene-3-carboxylic acid anilide |