5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) structure
|
Common Name | 5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) | ||
|---|---|---|---|---|
| CAS Number | 1467776-41-5 | Molecular Weight | 496.21 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 628.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H26B2N4O4S2 | Melting Point | 382 °C | |
| MSDS | USA | Flash Point | 333.8±30.1 °C | |
| Name | 5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 628.4±50.0 °C at 760 mmHg |
| Melting Point | 382 °C |
| Molecular Formula | C22H26B2N4O4S2 |
| Molecular Weight | 496.21 |
| Flash Point | 333.8±30.1 °C |
| Exact Mass | 496.158142 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | VZCYKOASVMGCSP-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cc3c(cc(B4OC(C)(C)C(C)(C)O4)c4nsnc43)c3nsnc23)OC1(C)C |
| RIDADR | NONH for all modes of transport |
|---|
|
5,10-Diborylated naphtho[1,2-c:5,6-c0]bis[1,2,5]-thiadiazole: a ready-to-use precursor for the synthesis of high-performance semiconducting polymers Kawashima, Kazuaki; et. al.
Polym. Chem. 4(20) , 5224-5227, (2013)
|
| 5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)[1,2,5]thiadiazolo[3',4':5,6]naphtho[1,2-c][1,2,5]thiadiazole |
| 5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis[1,2,5]thiadiazole |
| Naphtho[1,2-c:5,6-c']bis[1,2,5]thiadiazole, 5,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |
| MFCD28963789 |
| Naphtho[1,2-|c|:5,6-|c'|]bis([1,2,5]thiadiazole)-5,10-diboronic Acid Bis(pinacol) Ester|Bpin2-NTz |
| PB2-NTz |