1,1,2-trimethylbenzo[e]indole-6-sulfonic acid
Modify Date: 2025-08-23 22:29:21
![1,1,2-trimethylbenzo[e]indole-6-sulfonic acid Structure](https://image.chemsrc.com/caspic/225/146384-40-9.png)
1,1,2-trimethylbenzo[e]indole-6-sulfonic acid structure
|
Common Name | 1,1,2-trimethylbenzo[e]indole-6-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 146384-40-9 | Molecular Weight | 289.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2-trimethylbenzo[e]indole-6-sulfonic acid |
|---|
| Molecular Formula | C15H15NO3S |
|---|---|
| Molecular Weight | 289.35000 |
| Exact Mass | 289.07700 |
| PSA | 75.11000 |
| LogP | 3.98650 |
| InChIKey | WIKWUAPVIJGCOG-UHFFFAOYSA-N |
| SMILES | CC1=Nc2ccc3c(S(=O)(=O)O)cccc3c2C1(C)C |
| HS Code | 2933990090 |
|---|
|
~69%
1,1,2-trimethyl... CAS#:146384-40-9 |
| Literature: Langhals, Heinz; Varja, Ana; Laubichler, Peter; Kernt, Marcus; Eibl, Kirsten; Haritoglou, Christos Journal of Medicinal Chemistry, 2011 , vol. 54, # 11 p. 3903 - 3925 |
![1,1,2-Trimethyl-1H-benzo[e]indole structure](https://image.chemsrc.com/caspic/088/41532-84-7.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |