ethyl 2-[5,6-dichloro-2-(cyanoamino)-4H-quinazolin-3-yl]acetate
Modify Date: 2025-08-27 09:26:05
![ethyl 2-[5,6-dichloro-2-(cyanoamino)-4H-quinazolin-3-yl]acetate Structure](https://image.chemsrc.com/caspic/095/146374-56-3.png)
ethyl 2-[5,6-dichloro-2-(cyanoamino)-4H-quinazolin-3-yl]acetate structure
|
Common Name | ethyl 2-[5,6-dichloro-2-(cyanoamino)-4H-quinazolin-3-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 146374-56-3 | Molecular Weight | 327.16600 | |
| Density | 1.464g/cm3 | Boiling Point | 466.78ºC at 760 mmHg | |
| Molecular Formula | C13H12Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.101ºC | |
| Name | ethyl 2-[5,6-dichloro-2-(cyanoamino)-4H-quinazolin-3-yl]acetate |
|---|
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 466.78ºC at 760 mmHg |
| Molecular Formula | C13H12Cl2N4O2 |
| Molecular Weight | 327.16600 |
| Flash Point | 236.101ºC |
| Exact Mass | 326.03400 |
| PSA | 77.72000 |
| LogP | 2.69698 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | ZTQFDKVKDGLGQS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1Cc2c(ccc(Cl)c2Cl)N=C1NC#N |
|
~62%
ethyl 2-[5,6-di... CAS#:146374-56-3 |
| Literature: Trinka; Reiter Advanced Synthesis and Catalysis, 1997 , vol. 339, # 8 p. 750 - 753 |
|
~95%
ethyl 2-[5,6-di... CAS#:146374-56-3 |
| Literature: Trinka; Reiter Advanced Synthesis and Catalysis, 1997 , vol. 339, # 8 p. 750 - 753 |
|
~%
ethyl 2-[5,6-di... CAS#:146374-56-3 |
| Literature: Advanced Synthesis and Catalysis, , vol. 339, # 8 p. 750 - 753 |
|
~%
ethyl 2-[5,6-di... CAS#:146374-56-3 |
| Literature: Advanced Synthesis and Catalysis, , vol. 339, # 8 p. 750 - 753 |
CAS#:68475-42-3