Methyl 2-((Tert-Butyldimethylsilyl)Oxy)Acetate structure
|
Common Name | Methyl 2-((Tert-Butyldimethylsilyl)Oxy)Acetate | ||
|---|---|---|---|---|
| CAS Number | 146351-72-6 | Molecular Weight | 204.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H20O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[tert-butyl(dimethyl)silyl]oxyacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H20O3Si |
|---|---|
| Molecular Weight | 204.33900 |
| Exact Mass | 204.11800 |
| PSA | 35.53000 |
| LogP | 2.18120 |
| InChIKey | KTNTVTQVEAPQNT-UHFFFAOYSA-N |
| SMILES | COC(=O)CO[Si](C)(C)C(C)(C)C |
|
~98%
Methyl 2-((Tert... CAS#:146351-72-6 |
| Literature: Gennari, Cesare; Carcano, Michela; Donghi, Monica; Mongelli, Nicola; Vanotti, Ermes; Vulpetti, Anna Journal of Organic Chemistry, 1997 , vol. 62, # 14 p. 4746 - 4755 |
|
~99%
Methyl 2-((Tert... CAS#:146351-72-6 |
| Literature: Pharmacia and Upjohn S.p.A. Patent: US5767282 A1, 1998 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| methyl t-butyldimethylsilyloxyacetate |