3,7-Dimethyl-1H-indole-2-carbaldehyde
Modify Date: 2025-08-25 14:44:00
3,7-Dimethyl-1H-indole-2-carbaldehyde structure
|
Common Name | 3,7-Dimethyl-1H-indole-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 1463-72-5 | Molecular Weight | 173.21100 | |
| Density | 1.185g/cm3 | Boiling Point | 350.6ºC at 760mmHg | |
| Molecular Formula | C11H11NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.7ºC | |
| Name | 3,7-Dimethyl-1H-indole-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 350.6ºC at 760mmHg |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21100 |
| Flash Point | 173.7ºC |
| Exact Mass | 173.08400 |
| PSA | 32.86000 |
| LogP | 2.59720 |
| Vapour Pressure | 4.35E-05mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | KFMJRJKKDWLVBF-UHFFFAOYSA-N |
| SMILES | Cc1c(C=O)[nH]c2c(C)cccc12 |
| HS Code | 2933990090 |
|---|
|
~47%
3,7-Dimethyl-1H... CAS#:1463-72-5 |
| Literature: AFFINIUM PHARMACEUTICALS, INC. Patent: WO2007/53131 A2, 2007 ; Location in patent: Page/Page column 187 ; WO 2007/053131 A2 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-Dimethylindol-2-carbaldehyd |
| 3,7-dimethylindole-2-carbaldehyde |