N-[[1-(2,4-dichlorophenyl)-2-methyl-5-phenylpyrrol-3-yl]methyl]aniline structure
|
Common Name | N-[[1-(2,4-dichlorophenyl)-2-methyl-5-phenylpyrrol-3-yl]methyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 146204-78-6 | Molecular Weight | 407.33500 | |
| Density | 1.2g/cm3 | Boiling Point | 561.6ºC at 760 mmHg | |
| Molecular Formula | C24H20Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.4ºC | |
| Name | N-[[1-(2,4-dichlorophenyl)-2-methyl-5-phenylpyrrol-3-yl]methyl]aniline |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 561.6ºC at 760 mmHg |
| Molecular Formula | C24H20Cl2N2 |
| Molecular Weight | 407.33500 |
| Flash Point | 293.4ºC |
| Exact Mass | 406.10000 |
| PSA | 16.96000 |
| LogP | 7.44460 |
| Vapour Pressure | 1.22E-12mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | LRJWVCQKBCSIJS-UHFFFAOYSA-N |
| SMILES | Cc1c(CNc2ccccc2)cc(-c2ccccc2)n1-c1ccc(Cl)cc1Cl |
|
~20%
N-[[1-(2,4-dich... CAS#:146204-78-6 |
| Literature: Cerreto; Villa; Retico; Scalzo European Journal of Medicinal Chemistry, 1992 , vol. 27, # 7 p. 701 - 708 |