2-acetamido-N,N-bis(2-chloroethyl)-4-methyl-pentanamide structure
|
Common Name | 2-acetamido-N,N-bis(2-chloroethyl)-4-methyl-pentanamide | ||
|---|---|---|---|---|
| CAS Number | 1462-78-8 | Molecular Weight | 297.22100 | |
| Density | 1.141g/cm3 | Boiling Point | 461.2ºC at 760 mmHg | |
| Molecular Formula | C12H22Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.7ºC | |
| Name | 2-acetamido-N,N-bis(2-chloroethyl)-4-methylpentanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 461.2ºC at 760 mmHg |
| Molecular Formula | C12H22Cl2N2O2 |
| Molecular Weight | 297.22100 |
| Flash Point | 232.7ºC |
| Exact Mass | 296.10600 |
| PSA | 49.41000 |
| LogP | 2.23430 |
| Vapour Pressure | 1.09E-08mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | VCBNBXWKUQOFNK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC(C)C)C(=O)N(CCCl)CCCl |
|
~%
2-acetamido-N,N... CAS#:1462-78-8 |
| Literature: Levi,I. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 715 - 718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Acetamino-isocapronsaeure-<bis-(2-chlor-ethyl)-amid> |