Methylcarbamic acid 3,4,6-trichloro-2-nitrophenyl ester
Modify Date: 2025-08-24 19:22:36
Methylcarbamic acid 3,4,6-trichloro-2-nitrophenyl ester structure
|
Common Name | Methylcarbamic acid 3,4,6-trichloro-2-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 14572-50-0 | Molecular Weight | 299.49500 | |
| Density | 1.631g/cm3 | Boiling Point | 380.9ºC at 760 mmHg | |
| Molecular Formula | C8H5Cl3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | (3,4,6-trichloro-2-nitrophenyl) N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.631g/cm3 |
|---|---|
| Boiling Point | 380.9ºC at 760 mmHg |
| Molecular Formula | C8H5Cl3N2O4 |
| Molecular Weight | 299.49500 |
| Flash Point | 184.1ºC |
| Exact Mass | 297.93100 |
| PSA | 87.64000 |
| LogP | 4.00080 |
| Vapour Pressure | 5.28E-06mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | ZQIUPCJOANRBAP-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1c(Cl)cc(Cl)c(Cl)c1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Nitro-3,4,6-trichlorophenol methylcarbamate |
| Carbamic acid,methyl-,2-nitro-3,4,6-trichlorophenyl ester |
| Phenol,2-nitro-3,4,6-trichlloro-,methylcarbamate |