(2S,4S)-2-(4-methylphenyl)-4-propan-2-yl-1-oxa-2λ6-thia-3-azacyclopent-2-ene 2-oxide structure
|
Common Name | (2S,4S)-2-(4-methylphenyl)-4-propan-2-yl-1-oxa-2λ6-thia-3-azacyclopent-2-ene 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 145679-46-5 | Molecular Weight | 239.33400 | |
| Density | 1.19g/cm3 | Boiling Point | 336.8ºC at 760mmHg | |
| Molecular Formula | C12H17NO2S | Melting Point | 82-84ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 157.5ºC | |
| Name | (2S,4S)-2-(4-methylphenyl)-4-propan-2-yl-1-oxa-2λ6-thia-3-azacyclopent-2-ene 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 336.8ºC at 760mmHg |
| Melting Point | 82-84ºC(lit.) |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.33400 |
| Flash Point | 157.5ºC |
| Exact Mass | 239.09800 |
| PSA | 47.04000 |
| LogP | 3.09300 |
| Vapour Pressure | 0.000214mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | QCNBRUOJSNBOIE-WBMJQRKESA-N |
| SMILES | Cc1ccc(S2(=O)=NC(C(C)C)CO2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| MFCD03093980 |