Hydrazine, (2,5-dimethyl-4-nitrophenyl)- (9CI) structure
|
Common Name | Hydrazine, (2,5-dimethyl-4-nitrophenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 145655-61-4 | Molecular Weight | 181.19200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,5-Dimethyl-4-nitrophenyl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H11N3O2 |
|---|---|
| Molecular Weight | 181.19200 |
| Exact Mass | 181.08500 |
| PSA | 83.87000 |
| LogP | 2.79370 |
| InChIKey | DPRXXFCYJSBXDC-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1NN |
|
~%
Hydrazine, (2,5... CAS#:145655-61-4 |
| Literature: Alunni-Bistocchi, Giovanni; Orvietani, Pierluigi; Mauffret, Olivier; Antri, Said El; Deroussent, Alain; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 21 p. 2935 - 2942 |
| 2',5'-Dimethyl-4'-nitro-benzanilid |
| 2,5-Dimethyl-4-methylthiophenyl-trifluormethansulfonat |
| 2,5-Dimethyl-4-nitrophenylhydrazine |