3-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]propanoic acid
Modify Date: 2025-09-10 20:24:07
![3-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]propanoic acid Structure](https://image.chemsrc.com/caspic/295/1456-52-6.png)
3-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]propanoic acid structure
|
Common Name | 3-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1456-52-6 | Molecular Weight | 612.96900 | |
| Density | 2.289g/cm3 | Boiling Point | 611.2ºC at 760 mmHg | |
| Molecular Formula | C13H14I3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.5ºC | |
| Name | 3-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.289g/cm3 |
|---|---|
| Boiling Point | 611.2ºC at 760 mmHg |
| Molecular Formula | C13H14I3NO3 |
| Molecular Weight | 612.96900 |
| Flash Point | 323.5ºC |
| Exact Mass | 612.81100 |
| PSA | 57.61000 |
| LogP | 3.89040 |
| Vapour Pressure | 8.55E-16mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | LLLMGEDYKIIGPY-UHFFFAOYSA-N |
| SMILES | CCN(C(C)=O)c1c(I)cc(I)c(CCC(=O)O)c1I |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ioprocemic acid |
| Ioprocemic acid (USAN/INN) |
| UNII-BD20Y3892A |
| 3-{3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl}propanoic acid |