3,5-di(butan-2-yl)phenol structure
|
Common Name | 3,5-di(butan-2-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 14556-13-9 | Molecular Weight | 206.32400 | |
| Density | 0.933g/cm3 | Boiling Point | 302.1ºC at 760 mmHg | |
| Molecular Formula | C14H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.4ºC | |
| Name | 3,5-di(butan-2-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.933g/cm3 |
|---|---|
| Boiling Point | 302.1ºC at 760 mmHg |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.32400 |
| Flash Point | 140.4ºC |
| Exact Mass | 206.16700 |
| PSA | 20.23000 |
| LogP | 4.41920 |
| Vapour Pressure | 0.000566mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | PFBHMJJMZWUEAI-UHFFFAOYSA-N |
| SMILES | CCC(C)c1cc(O)cc(C(C)CC)c1 |
|
~%
3,5-di(butan-2-... CAS#:14556-13-9 |
| Literature: Nesterova, T. N.; Pimerzin, A. A.; Rozhnov, A. M.; Karlina, T. N. Journal of Chemical Thermodynamics, 1989 , vol. 21, # 4 p. 385 - 396 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3,5-Di-sec-butylphenol |