N-(2-benzylphenyl)-5-methyl-1,2-oxazole-3-carboxamide structure
|
Common Name | N-(2-benzylphenyl)-5-methyl-1,2-oxazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 145440-87-5 | Molecular Weight | 292.33200 | |
| Density | 1.218g/cm3 | Boiling Point | 406ºC at 760mmHg | |
| Molecular Formula | C18H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.3ºC | |
| Name | N-(2-benzylphenyl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 406ºC at 760mmHg |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.33200 |
| Flash Point | 199.3ºC |
| Exact Mass | 292.12100 |
| PSA | 55.13000 |
| LogP | 3.89910 |
| Vapour Pressure | 8.4E-07mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | KNDVOAMVMMCGKC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)Nc2ccccc2Cc2ccccc2)no1 |
|
~%
N-(2-benzylphen... CAS#:145440-87-5 |
| Literature: Lepage; Tombret; Cuvier; Marivain; Gillardin European Journal of Medicinal Chemistry, 1992 , vol. 27, # 6 p. 581 - 593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms2989i16 |