2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione structure
|
Common Name | 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 145178-53-6 | Molecular Weight | 226.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-bis(trimethylsilyl)buta-1,3-diene-1,4-dione |
|---|
| Molecular Formula | C10H18O2Si2 |
|---|---|
| Molecular Weight | 226.42000 |
| Exact Mass | 226.08500 |
| PSA | 34.14000 |
| LogP | 2.25720 |
| InChIKey | HCSIDQIGMXXMBO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(=C=O)C(=C=O)[Si](C)(C)C |
|
~69%
2,3-bis(trimeth... CAS#:145178-53-6 |
| Literature: Zhao, Da-Chuan; Tidwell, Thomas T. Journal of the American Chemical Society, 1992 , vol. 114, # 27 p. 10980 - 10981 |
| Precursor 1 | |
|---|---|
| DownStream 8 | |