Indolin-5-yldimethylphosphine oxide
Modify Date: 2026-07-04 21:03:30
Indolin-5-yldimethylphosphine oxide structure
|
Common Name | Indolin-5-yldimethylphosphine oxide | ||
|---|---|---|---|---|
| CAS Number | 145159-59-7 | Molecular Weight | 195.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14NOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Indolin-5-yldimethylphosphine oxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14NOP |
|---|---|
| Molecular Weight | 195.20 |
| InChIKey | XPMDYRNKFZHIIZ-UHFFFAOYSA-N |
| SMILES | CP(C)(=O)c1ccc2c(c1)CCN2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Indolin-5-yldimethylphosphine oxide? |
| A: Molecular formula of Indolin-5-yldimethylphosphine oxide is C10H14NOP. |
| Q: What is the Chinese name of 145159-59-7? |
| A: Chinese name of 145159-59-7 is 145159-59-7. |
| Q: What is the SMILES notation of Indolin-5-yldimethylphosphine oxide? |
| A: SMILES notation of Indolin-5-yldimethylphosphine oxide is CP(C)(=O)c1ccc2c(c1)CCN2. |
| Q: What is the InChIKey of Indolin-5-yldimethylphosphine oxide? |
| A: InChIKey of Indolin-5-yldimethylphosphine oxide is XPMDYRNKFZHIIZ-UHFFFAOYSA-N. |
| Q: What is the English name of Indolin-5-yldimethylphosphine oxide? |
| A: The English name of Indolin-5-yldimethylphosphine oxide is Indolin-5-yldimethylphosphine oxide. |
| Q: What is the molecular weight of Indolin-5-yldimethylphosphine oxide? |
| A: Molecular weight of Indolin-5-yldimethylphosphine oxide is 195.20. |
| Q: What is the CAS number of Indolin-5-yldimethylphosphine oxide? |
| A: CAS number of Indolin-5-yldimethylphosphine oxide is 145159-59-7. |