Bis[2-(p-chlorophenoxy)-2-methylpropionic acid]propylene ester
Modify Date: 2025-08-26 19:33:31
![Bis[2-(p-chlorophenoxy)-2-methylpropionic acid]propylene ester Structure](https://image.chemsrc.com/caspic/405/14496-66-3.png)
Bis[2-(p-chlorophenoxy)-2-methylpropionic acid]propylene ester structure
|
Common Name | Bis[2-(p-chlorophenoxy)-2-methylpropionic acid]propylene ester | ||
|---|---|---|---|---|
| CAS Number | 14496-66-3 | Molecular Weight | 469.35500 | |
| Density | 1.24g/cm3 | Boiling Point | 542.2ºC at 760mmHg | |
| Molecular Formula | C23H26Cl2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.1ºC | |
| Name | 2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxypropyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 542.2ºC at 760mmHg |
| Molecular Formula | C23H26Cl2O6 |
| Molecular Weight | 469.35500 |
| Flash Point | 173.1ºC |
| Exact Mass | 468.11100 |
| PSA | 71.06000 |
| LogP | 5.48330 |
| Vapour Pressure | 8.08E-12mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | XBGRDKKBYZSYFW-UHFFFAOYSA-N |
| SMILES | CC(COC(=O)C(C)(C)Oc1ccc(Cl)cc1)OC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |