ethyl 4-[6-[4-(C-ethoxycarbonimidoyl)phenoxy]hexoxy]benzenecarboximidate structure
|
Common Name | ethyl 4-[6-[4-(C-ethoxycarbonimidoyl)phenoxy]hexoxy]benzenecarboximidate | ||
|---|---|---|---|---|
| CAS Number | 1448-62-0 | Molecular Weight | 412.52200 | |
| Density | 1.08g/cm3 | Boiling Point | 522.2ºC at 760mmHg | |
| Molecular Formula | C24H32N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.6ºC | |
| Name | ethyl 4-[6-[4-(C-ethoxycarbonimidoyl)phenoxy]hexoxy]benzenecarboximidate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 522.2ºC at 760mmHg |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.52200 |
| Flash Point | 269.6ºC |
| Exact Mass | 412.23600 |
| PSA | 84.62000 |
| LogP | 5.62800 |
| Vapour Pressure | 1.75E-10mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | MWWKZZZOWHMXBG-UHFFFAOYSA-N |
| SMILES | CCOC(=N)c1ccc(OCCCCCCOc2ccc(C(=N)OCC)cc2)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Diethyl 4,4'-(hexamethylenebis(oxy))dibenzimidate |
| Benzenecarboximidicacid,4,4'-[1,6-hexanediylbis(oxy)]bis-,diethyl ester |
| diethyl 4,4'-[hexane-1,6-diylbis(oxy)]dibenzenecarboximidoate |
| EINECS 215-904-2 |