4-methylamidatetiazofurin
Modify Date: 2024-01-08 10:33:37
4-methylamidatetiazofurin structure
|
Common Name | 4-methylamidatetiazofurin | ||
|---|---|---|---|---|
| CAS Number | 144660-79-7 | Molecular Weight | 274.29400 | |
| Density | 1.75g/cm3 | Boiling Point | 495.8ºC at 760mmHg | |
| Molecular Formula | C10H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.6ºC | |
| Name | methyl 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-thiazole-4-carboximidate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 495.8ºC at 760mmHg |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.29400 |
| Flash Point | 253.6ºC |
| Exact Mass | 274.06200 |
| PSA | 144.13000 |
| Vapour Pressure | 1.2E-10mmHg at 25°C |
| Index of Refraction | 1.714 |
| InChIKey | ZWHJLJBFDVMAJQ-WCTZXXKLSA-N |
| SMILES | COC(=N)c1csc(C2OC(CO)C(O)C2O)n1 |
|
~68%
4-methylamidate... CAS#:144660-79-7 |
| Literature: Phelan; Gabrielsen; Kirsi; Shannon; Ussery; Barthel- Rosa; Schubert; Kini; Robins Nucleosides and Nucleotides, 1995 , vol. 14, # 6 p. 1315 - 1327 |
|
~%
4-methylamidate... CAS#:144660-79-7 |
| Literature: Phelan; Gabrielsen; Kirsi; Shannon; Ussery; Barthel- Rosa; Schubert; Kini; Robins Nucleosides and Nucleotides, 1995 , vol. 14, # 6 p. 1315 - 1327 |
|
~%
4-methylamidate... CAS#:144660-79-7 |
| Literature: Phelan; Gabrielsen; Kirsi; Shannon; Ussery; Barthel- Rosa; Schubert; Kini; Robins Nucleosides and Nucleotides, 1995 , vol. 14, # 6 p. 1315 - 1327 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Methylamidatetiazofurin |
| 4-methylmidatetiazofurin |