Oxyresveratrol 3'-O-beta-D-glucopyranoside
Modify Date: 2025-12-08 09:20:41
Oxyresveratrol 3'-O-beta-D-glucopyranoside structure
|
Common Name | Oxyresveratrol 3'-O-beta-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 144525-40-6 | Molecular Weight | 406.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Oxyresveratrol 3'-O-beta-D-glucopyranosideOxyresveratrol 3'-O-β-D-glucopyranoside is a phenolic compound isolated from Morus nigra root and is an effective tyrosinase inhibitor with an IC50 of 1.64 μM[1]. |
| Name | oxyresveratrol 3-O-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Oxyresveratrol 3'-O-β-D-glucopyranoside is a phenolic compound isolated from Morus nigra root and is an effective tyrosinase inhibitor with an IC50 of 1.64 μM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 1.64 μM (Tyrosinase)[1] |
| References |
| Molecular Formula | C20H22O9 |
|---|---|
| Molecular Weight | 406.38300 |
| Exact Mass | 406.12600 |
| PSA | 160.07000 |
| LogP | 0.15250 |
| InChIKey | GGQVPULXXVQLRT-CUYWLFDKSA-N |
| SMILES | OCC1OC(Oc2cc(O)cc(C=Cc3ccc(O)cc3O)c2)C(O)C(O)C1O |
| (2S,3R,4S,5S,6R)-2-{3-[(E)-2-(2,4-Dihydroxy-phenyl)-vinyl]-5-hydroxy-phenoxy}-6-hydroxymethyl-tetrahydro-pyran-3,4,5-triol |
| 3-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-5-hydroxyphenyl β-D-glucopyranoside |
| oxyresveratrol-3-O-β-D-glucopyranoside |
| oxyresveratrol-3-O-β-D-glycopyranoside |
| oxyresveratrol 3'-O-β-D-glucopyranoside |
| oxyresveratrol-3'-O-β-D-glucopyranoside |
| oxyresveratrol 3'-O-β-glucopyranoside |