2,3-dibromo-1-(4-fluorophenyl)-3-phenylpropan-1-one structure
|
Common Name | 2,3-dibromo-1-(4-fluorophenyl)-3-phenylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 144442-95-5 | Molecular Weight | 386.05400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11Br2FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-dibromo-1-(4-fluorophenyl)-3-phenylpropan-1-one |
|---|
| Molecular Formula | C15H11Br2FO |
|---|---|
| Molecular Weight | 386.05400 |
| Exact Mass | 383.91600 |
| PSA | 17.07000 |
| LogP | 4.90810 |
| InChIKey | IKRSSTQFFICMAE-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)C(Br)C(Br)c1ccccc1 |
|
~76%
2,3-dibromo-1-(... CAS#:144442-95-5 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 81, # 9 p. 892 - 894 |
|
~%
2,3-dibromo-1-(... CAS#:144442-95-5 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 81, # 9 p. 892 - 894 |
|
~%
2,3-dibromo-1-(... CAS#:144442-95-5 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 81, # 9 p. 892 - 894 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |