2-amino-2'-nitro-Benzophenone
Modify Date: 2025-08-25 18:17:56
2-amino-2'-nitro-Benzophenone structure
|
Common Name | 2-amino-2'-nitro-Benzophenone | ||
|---|---|---|---|---|
| CAS Number | 1444-72-0 | Molecular Weight | 242.23000 | |
| Density | 1.333g/cm3 | Boiling Point | 486.1ºC at 760mmHg | |
| Molecular Formula | C13H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.8ºC | |
| Name | 2-amino-2'-nitro-Benzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 486.1ºC at 760mmHg |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23000 |
| Flash Point | 247.8ºC |
| Exact Mass | 242.06900 |
| PSA | 88.91000 |
| LogP | 3.51240 |
| Vapour Pressure | 1.33E-09mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | PMBOBOCOXFKIAG-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2922399090 |
|---|
|
~%
2-amino-2'-nitr... CAS#:1444-72-0 |
| Literature: Hey; Mulley Journal of the Chemical Society, 1952 , p. 2276,2283 |
|
~%
2-amino-2'-nitr... CAS#:1444-72-0 |
| Literature: Heyl Chemische Berichte, 1898 , vol. 31, p. 3034 Journal fuer Praktische Chemie (Leipzig), 1899 , vol. <2> 59, p. 450 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:2894-45-3
CAS#:2894-44-2| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-nitro-2',4'-dihydroxyazobenzene |
| 2'-Nitro-2-acetamino-diphenyl |
| 2'-Nitro-2-acetamino-biphenyl |
| 2'-Nitro-2.4-dioxy-azobenzol |
| 2-Nitro-2'-amino-benzophenon |