Benzenamine,2,4-dinitro-N-(2-nitrophenyl)- structure
|
Common Name | Benzenamine,2,4-dinitro-N-(2-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 14434-10-7 | Molecular Weight | 304.21500 | |
| Density | 1.592g/cm3 | Boiling Point | 463ºC at 760mmHg | |
| Molecular Formula | C12H8N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.8ºC | |
| Name | 2,4-dinitro-N-(2-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.592g/cm3 |
|---|---|
| Boiling Point | 463ºC at 760mmHg |
| Molecular Formula | C12H8N4O6 |
| Molecular Weight | 304.21500 |
| Flash Point | 233.8ºC |
| Exact Mass | 304.04400 |
| PSA | 149.49000 |
| LogP | 4.79740 |
| Vapour Pressure | 9.42E-09mmHg at 25°C |
| Index of Refraction | 1.717 |
| InChIKey | RHTGPRLQFAYVBM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccccc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| HS Code | 2921420090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2.4.2'-Trinitro-diphenylamin |
| 2,2',4-Trinitrodiphenylamin |
| EINECS 238-406-7 |