3-benzylidene-4-thia-8-azabicyclo[3.3.0]octa-6,9-dien-2-one
Modify Date: 2025-09-27 23:14:37
![3-benzylidene-4-thia-8-azabicyclo[3.3.0]octa-6,9-dien-2-one Structure](https://image.chemsrc.com/caspic/120/1443-75-0.png)
3-benzylidene-4-thia-8-azabicyclo[3.3.0]octa-6,9-dien-2-one structure
|
Common Name | 3-benzylidene-4-thia-8-azabicyclo[3.3.0]octa-6,9-dien-2-one | ||
|---|---|---|---|---|
| CAS Number | 1443-75-0 | Molecular Weight | 227.28200 | |
| Density | 1.415g/cm3 | Boiling Point | 449.5ºC at 760mmHg | |
| Molecular Formula | C13H9NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E)-2-benzylidene-4H-thieno[3,2-b]pyrrol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 449.5ºC at 760mmHg |
| Molecular Formula | C13H9NOS |
| Molecular Weight | 227.28200 |
| Exact Mass | 227.04000 |
| PSA | 58.16000 |
| LogP | 3.34420 |
| Vapour Pressure | 2.85E-08mmHg at 25°C |
| Index of Refraction | 1.776 |
| InChIKey | KQCXLNZGVDLLSJ-DHZHZOJOSA-N |
| SMILES | O=C1C(=Cc2ccccc2)Sc2cc[nH]c21 |
|
~%
3-benzylidene-4... CAS#:1443-75-0 |
| Literature: Tuite,R.J.; Snyder,H.R. Journal of the American Chemical Society, 1960 , vol. 82, p. 4364 - 4367 |
![3H-Thieno[3,2-b]pyrrol-3-one,2,4-dihydro- structure](https://image.chemsrc.com/caspic/043/1122-08-3.png)
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![2H-Thieno[3,2-b]pyrrol-3(4H)-one,2-benzylidene-6-[(dimethylamino)methyl]- (7CI,8CI) structure](https://image.chemsrc.com/caspic/076/1154-62-7.png)
CAS#:1154-62-7| 3-Oxo-2-benzyliden-2H.3H-thieno<3,2-b>pyrrol |
| 3-Oxo-2-azaspiro<4.6>undecan |
| 2-Benzyliden-2H,3H-thieno<3,2-b>pyrrol-3-on |