Butyryl fentanyl hydrochloride
Modify Date: 2025-10-20 17:41:54
Butyryl fentanyl hydrochloride structure
|
Common Name | Butyryl fentanyl hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1443-52-3 | Molecular Weight | 386.958 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H31ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Butyryl fentanyl hydrochlorideButyryl fentanyl (hydrochloride) binds the μ-opioid receptor with lower affinity compared to fentanyl (IC50s = 60 versus 2 nM and Kis = 32 versus 1.06 nM, respectively). |
| Name | N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]butanamide hydrochlor ide (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H31ClN2O |
|---|---|
| Molecular Weight | 386.958 |
| Exact Mass | 386.212494 |
| PSA | 23.55000 |
| LogP | 5.26670 |
| InChIKey | OHCXSXCINRZXIB-UHFFFAOYSA-N |
| SMILES | CCCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1.Cl |
| Butanamide, N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-, hydrochloride (1:1) |
| N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]butanamide hydrochloride (1:1) |