1-amino-3-[4-(trifluoromethoxy)phenyl]urea
Modify Date: 2025-11-23 19:04:17
![1-amino-3-[4-(trifluoromethoxy)phenyl]urea Structure](https://image.chemsrc.com/caspic/096/144172-28-1.png)
1-amino-3-[4-(trifluoromethoxy)phenyl]urea structure
|
Common Name | 1-amino-3-[4-(trifluoromethoxy)phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 144172-28-1 | Molecular Weight | 235.16300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-3-[4-(trifluoromethoxy)phenyl]urea |
|---|
| Molecular Formula | C8H8F3N3O2 |
|---|---|
| Molecular Weight | 235.16300 |
| Exact Mass | 235.05700 |
| PSA | 79.87000 |
| LogP | 2.55810 |
| InChIKey | TYFYWJUGQMIDIZ-UHFFFAOYSA-N |
| SMILES | NNC(=O)Nc1ccc(OC(F)(F)F)cc1 |
|
~%
1-amino-3-[4-(t... CAS#:144172-28-1 |
| Literature: Kitazaki, Tomoyuki; Tamura, Norikazu; Tasaka, Akihiro; Matsushita, Yoshihiro; Hayashi, Ryogo; Okonogi, Kenji; Itoh, Katsumi Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 2 p. 314 - 327 |
|
~%
1-amino-3-[4-(t... CAS#:144172-28-1 |
| Literature: Kitazaki, Tomoyuki; Tamura, Norikazu; Tasaka, Akihiro; Matsushita, Yoshihiro; Hayashi, Ryogo; Okonogi, Kenji; Itoh, Katsumi Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 2 p. 314 - 327 |
![phenyl N-[4-(trifluoromethoxy)phenyl]carbamate structure](https://image.chemsrc.com/caspic/432/155432-10-3.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |