methyl (3E)-6-chloro-3-hydrazinylidene-2-hydroxy-1H-indene-2-carboxylate structure
|
Common Name | methyl (3E)-6-chloro-3-hydrazinylidene-2-hydroxy-1H-indene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 144172-26-9 | Molecular Weight | 254.67000 | |
| Density | 1.504 g/cm3 | Boiling Point | 376.316ºC at 760 mmHg | |
| Molecular Formula | C11H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.39ºC | |
| Name | methyl (3E)-6-chloro-3-hydrazinylidene-2-hydroxy-1H-indene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.504 g/cm3 |
|---|---|
| Boiling Point | 376.316ºC at 760 mmHg |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67000 |
| Flash Point | 181.39ºC |
| Exact Mass | 254.04600 |
| PSA | 84.91000 |
| LogP | 1.16330 |
| InChIKey | JCVOGCGLEKVMAX-ZROIWOOFSA-N |
| SMILES | COC(=O)C1(O)Cc2cc(Cl)ccc2C1=NN |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Methyl 5-chloro-1-hydrazono-2-hydroxy-2,3-dihydro-1H-indene-2-carboxylate |