Secalciferol-d6 structure
|
Common Name | Secalciferol-d6 | ||
|---|---|---|---|---|
| CAS Number | 1440957-55-0 | Molecular Weight | 422.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H38D6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Secalciferol-d6Secalciferol-d6 ((24R)-24,25-Dihydroxyvitamin D3-d6) is the deuterium labeled Secalciferol. Secalciferol is a metabolite of Vitamin D, a possibly anti-inflammatory steroid which is involved in bone ossification[1][2]. |
| Name | Secalciferol-d6 |
|---|
| Description | Secalciferol-d6 ((24R)-24,25-Dihydroxyvitamin D3-d6) is the deuterium labeled Secalciferol. Secalciferol is a metabolite of Vitamin D, a possibly anti-inflammatory steroid which is involved in bone ossification[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C27H38D6O3 |
|---|---|
| Molecular Weight | 422.68 |
| InChIKey | FCKJYANJHNLEEP-YIZZJVCQSA-N |
| SMILES | C=C1CCC(O)CC1=CC=C1CCCC2(C)C1CCC2C(C)CCC(O)C(C)(C)O |