2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine copper(II)
Modify Date: 2025-08-27 17:25:39
2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine copper(II) structure
|
Common Name | 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine copper(II) | ||
|---|---|---|---|---|
| CAS Number | 14409-63-3 | Molecular Weight | 596.30700 | |
| Density | N/A | Boiling Point | 804.9ºC at 760mmHg | |
| Molecular Formula | C36H44CuN4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 335.1ºC | |
| Name | copper(II) 2,3,7,8,12,13,17,18-octaethylporphine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 804.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C36H44CuN4 |
| Molecular Weight | 596.30700 |
| Flash Point | 335.1ºC |
| Exact Mass | 595.28600 |
| PSA | 34.58000 |
| LogP | 6.13170 |
| Vapour Pressure | 6.24E-25mmHg at 25°C |
| InChIKey | WYWUPEFEFRBNGN-UHFFFAOYSA-N |
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4[n-]c(cc5nc(cc1n2)C(CC)=C5CC)c(CC)c4CC)c(CC)c3CC.[Cu+2] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
|
Two-dimensional supramolecular organization of copper octaethylporphyrin and cobalt phthalocyanine on Au(111): molecular assembly control at an electrochemical interface.
J. Am. Chem. Soc. 126(27) , 8540-5, (2004) Mixed adlayers of 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine copper(II) (CuOEP) and cobalt(II) phthalocyanine (CoPc) were prepared by immersing Au(111) substrate in a benzene solution containing C... |
|
|
Structure of (2,3,7,8,12,13,17,18-octaethylporphinato)copper(II).
Acta Crystallogr. C 47 ( Pt 2) , 431-3, (1991) [Cu(C36H44N4)], Mr = 596.3, triclinic, P1, a = 13.314(5), b = 13.392(5), c = 4.805(3) A, alpha = 92.42(4), beta = 93.38(4), gamma = 113.08(1) degrees, V = 784.8 A3, Z = 1, Dx = 1.26 g cm-3, Dm = 1.25 ... |
| copper-2,3,7,8,12,13,17,18-octaethylporphyrin |
| MFCD00012150 |
| copper-2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphyrin |