ethyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indole-5-carboxylate structure
|
Common Name | ethyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 144055-85-6 | Molecular Weight | 332.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indole-5-carboxylate |
|---|
| Molecular Formula | C18H24N2O4 |
|---|---|
| Molecular Weight | 332.39400 |
| Exact Mass | 332.17400 |
| PSA | 83.91000 |
| LogP | 3.61620 |
| InChIKey | OKEOBVFOMOCMIR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc2[nH]cc(CCNC(=O)OC(C)(C)C)c2c1 |
| HS Code | 2933990090 |
|---|
|
~62%
ethyl 3-[2-[(2-... CAS#:144055-85-6 |
| Literature: Merck Sharpe and Dohme, Ltd. Patent: US5208248 A1, 1993 ; US 5208248 A |
|
~70%
ethyl 3-[2-[(2-... CAS#:144055-85-6 |
| Literature: Castro, Jose L.; Baker, Raymond; Guiblin, Alexander R.; Hobbs, Sarah C.; Jenkins, Matthew; et al. Journal of Medicinal Chemistry, 1994 , vol. 37, # 19 p. 3023 - 3032 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |